C12H21N — CID 143113134
(6E)-N-propylnona-1,6-dien-5-imine (PubChem CID 143113134) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (6E)-N-propylnona-1,6-dien-5-imine.
| Compound Name | (6E)-N-propylnona-1,6-dien-5-imine |
|---|---|
| PubChem CID | 143113134 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (6E)-N-propylnona-1,6-dien-5-imine |
| SMILES | C=CCCC(/C=C/CC)=N\CCC |
| InChI | InChI=1S/C12H21N/c1-4-7-9-12(10-8-5-2)13-11-6-3/h4,8,10H,1,5-7,9,11H2,2-3H3/b10-8+,13-12+ |
| InChIKey | VXDPRZLWQOCZMO-QZWQQMBISA-N |
| XLogP | 3.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|