C24H33P — CID 143113218
[(1E,6Z)-cycloocta-1,6-dien-1-yl]-[(2E,4Z)-octa-2,4,7-trien-3-yl]-phenylphosphane;ethane (PubChem CID 143113218) has the molecular formula C24H33P and a molecular weight of 352.50 g/mol. Its IUPAC name is [(1E,6Z)-cycloocta-1,6-dien-1-yl]-[(2E,4Z)-octa-2,4,7-trien-3-yl]-phenylphosphane;ethane.
| Compound Name | [(1E,6Z)-cycloocta-1,6-dien-1-yl]-[(2E,4Z)-octa-2,4,7-trien-3-yl]-phenylphosphane;ethane |
|---|---|
| PubChem CID | 143113218 |
| Molecular Formula | C24H33P |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | [(1E,6Z)-cycloocta-1,6-dien-1-yl]-[(2E,4Z)-octa-2,4,7-trien-3-yl]-phenylphosphane;ethane |
| SMILES | C=CC/C=C\C(=C/C)P(/C1=C/CCC/C=C\C1)c1ccccc1.CC |
| InChI | InChI=1S/C22H27P.C2H6/c1-3-5-10-15-20(4-2)23(22-18-13-9-14-19-22)21-16-11-7-6-8-12-17-21;1-2/h3-4,7,9-11,13-15,17-19H,1,5-6,8,12,16H2,2H3;1-2H3/b11-7-,15-10-,20-4+,21-17+; |
| InChIKey | UWFXRINCKOUGCZ-IRYOXULYSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|