About 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol
6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol (PubChem CID 143113223) has the molecular formula C21H18N2O
and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol.
Molecular Properties
| Compound Name | 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol |
| PubChem CID | 143113223 |
| Molecular Formula | C21H18N2O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol |
| SMILES | Cc1ccccc1-n1c(C2=CC=CC=C(O)C2)nc2ccccc21 |
| InChI | InChI=1S/C21H18N2O/c1-15-8-2-6-12-19(15)23-20-13-7-5-11-18(20)22-21(23)16-9-3-4-10-17(24)14-16/h2-13,24H,14H2,1H3 |
| InChIKey | MWKBZVINPFIQOG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol?
The IUPAC name of 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol (CID 143113223) is 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol.
What is the SMILES notation for 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol?
The canonical SMILES for 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol is Cc1ccccc1-n1c(C2=CC=CC=C(O)C2)nc2ccccc21.
What is the InChIKey of 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol?
The InChIKey is MWKBZVINPFIQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O/c1-15-8-2-6-12-19(15)23-20-13-7-5-11-18(20)22-21(23)16-9-3-4-10-17(24)14-16/h2-13,24H,14H2,1H3.
What are the key properties of 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol?
6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol has a molecular weight of 314.39 g/mol, XLogP of 5.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(2-methylphenyl)benzimidazol-2-yl]cyclohepta-1,3,5-trien-1-ol is sourced from PubChem (CID 143113223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).