C16H25N3 — CID 143113276
N-(cyclopropylmethyl)-N-(pyridin-3-ylmethyl)azepan-4-amine (PubChem CID 143113276) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-(pyridin-3-ylmethyl)azepan-4-amine.
| Compound Name | N-(cyclopropylmethyl)-N-(pyridin-3-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 143113276 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-(cyclopropylmethyl)-N-(pyridin-3-ylmethyl)azepan-4-amine |
| SMILES | c1cncc(CN(CC2CC2)C2CCCNCC2)c1 |
| InChI | InChI=1S/C16H25N3/c1-3-15(11-18-9-1)13-19(12-14-5-6-14)16-4-2-8-17-10-7-16/h1,3,9,11,14,16-17H,2,4-8,10,12-13H2 |
| InChIKey | FENXVFPXUGLFFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |