C21H37N5 — CID 143113694
N'-[[1-(2,3,4,4b,5,6,8a,9-octahydro-1H-pyrido[3,4-b]indol-3-ylmethyl)piperidin-3-yl]methyl]propane-1,3-diamine (PubChem CID 143113694) has the molecular formula C21H37N5 and a molecular weight of 359.56 g/mol. Its IUPAC name is N'-[[1-(2,3,4,4b,5,6,8a,9-octahydro-1H-pyrido[3,4-b]indol-3-ylmethyl)piperidin-3-yl]methyl]propane-1,3-diamine.
| Compound Name | N'-[[1-(2,3,4,4b,5,6,8a,9-octahydro-1H-pyrido[3,4-b]indol-3-ylmethyl)piperidin-3-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143113694 |
| Molecular Formula | C21H37N5 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | N'-[[1-(2,3,4,4b,5,6,8a,9-octahydro-1H-pyrido[3,4-b]indol-3-ylmethyl)piperidin-3-yl]methyl]propane-1,3-diamine |
| SMILES | NCCCNCC1CCCN(CC2CC3=C(CN2)NC2C=CCCC32)C1 |
| InChI | InChI=1S/C21H37N5/c22-8-4-9-23-12-16-5-3-10-26(14-16)15-17-11-19-18-6-1-2-7-20(18)25-21(19)13-24-17/h2,7,16-18,20,23-25H,1,3-6,8-15,22H2 |
| InChIKey | YHILKMKDZLZTAK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|