About [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol
[4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol (PubChem CID 143114009) has the molecular formula C15H13F6NO
and a molecular weight of 337.26 g/mol. Its IUPAC name is [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol |
| PubChem CID | 143114009 |
| Molecular Formula | C15H13F6NO |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol |
| SMILES | OCc1ccc(CCC2N=C(C(F)(F)F)C=C2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F6NO/c16-14(17,18)11-7-13(15(19,20)21)22-12(11)6-5-9-1-3-10(8-23)4-2-9/h1-4,7,12,23H,5-6,8H2 |
| InChIKey | RBICDNLFEFILSU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol?
The IUPAC name of [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol (CID 143114009) is [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol.
What is the SMILES notation for [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol?
The canonical SMILES for [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol is OCc1ccc(CCC2N=C(C(F)(F)F)C=C2C(F)(F)F)cc1.
What is the InChIKey of [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol?
The InChIKey is RBICDNLFEFILSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F6NO/c16-14(17,18)11-7-13(15(19,20)21)22-12(11)6-5-9-1-3-10(8-23)4-2-9/h1-4,7,12,23H,5-6,8H2.
What are the key properties of [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol?
[4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol has a molecular weight of 337.26 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[3,5-bis(trifluoromethyl)-2H-pyrrol-2-yl]ethyl]phenyl]methanol is sourced from PubChem (CID 143114009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).