About 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide
4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide (PubChem CID 1431141) has the molecular formula C21H26N2O3S2
and a molecular weight of 418.58 g/mol. Its IUPAC name is 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide |
| PubChem CID | 1431141 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccccc1N(C1=NCCCS1)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-21(2,3)16-10-12-17(13-11-16)28(24,25)23(20-22-14-7-15-27-20)18-8-5-6-9-19(18)26-4/h5-6,8-13H,7,14-15H2,1-4H3 |
| InChIKey | KVBOLEVPXWKPPW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide?
The IUPAC name of 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide (CID 1431141) is 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide.
What is the SMILES notation for 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide?
The canonical SMILES for 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide is COc1ccccc1N(C1=NCCCS1)S(=O)(=O)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide?
The InChIKey is KVBOLEVPXWKPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O3S2/c1-21(2,3)16-10-12-17(13-11-16)28(24,25)23(20-22-14-7-15-27-20)18-8-5-6-9-19(18)26-4/h5-6,8-13H,7,14-15H2,1-4H3.
What are the key properties of 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide?
4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide has a molecular weight of 418.58 g/mol, XLogP of 4.68, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(2-methoxyphenyl)benzenesulfonamide is sourced from PubChem (CID 1431141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).