C10H13ClS — CID 143114397
(3Z,5E,8Z)-5-chloro-8-ethyl-2,7-dihydrothionine (PubChem CID 143114397) has the molecular formula C10H13ClS and a molecular weight of 200.73 g/mol. Its IUPAC name is (3Z,5E,8Z)-5-chloro-8-ethyl-2,7-dihydrothionine.
| Compound Name | (3Z,5E,8Z)-5-chloro-8-ethyl-2,7-dihydrothionine |
|---|---|
| PubChem CID | 143114397 |
| Molecular Formula | C10H13ClS |
| Molecular Weight | 200.73 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (3Z,5E,8Z)-5-chloro-8-ethyl-2,7-dihydrothionine |
| SMILES | CC/C1=C/SC/C=C\C(Cl)=C/C1 |
| InChI | InChI=1S/C10H13ClS/c1-2-9-5-6-10(11)4-3-7-12-8-9/h3-4,6,8H,2,5,7H2,1H3/b4-3-,9-8-,10-6+ |
| InChIKey | XYODGHQKBBNLNH-GELBUTGUSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |