About 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate
2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate (PubChem CID 143114506) has the molecular formula C25H16O5S
and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate |
| PubChem CID | 143114506 |
| Molecular Formula | C25H16O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate |
| SMILES | O=C(Oc1ccccc1)c1ccc(C(=O)OC2c3ccccc3Oc3ccccc32)s1 |
| InChI | InChI=1S/C25H16O5S/c26-24(28-16-8-2-1-3-9-16)21-14-15-22(31-21)25(27)30-23-17-10-4-6-12-19(17)29-20-13-7-5-11-18(20)23/h1-15,23H |
| InChIKey | HWSKASGHJQNNPX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate?
The IUPAC name of 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate (CID 143114506) is 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate.
What is the SMILES notation for 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate?
The canonical SMILES for 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate is O=C(Oc1ccccc1)c1ccc(C(=O)OC2c3ccccc3Oc3ccccc32)s1.
What is the InChIKey of 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate?
The InChIKey is HWSKASGHJQNNPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16O5S/c26-24(28-16-8-2-1-3-9-16)21-14-15-22(31-21)25(27)30-23-17-10-4-6-12-19(17)29-20-13-7-5-11-18(20)23/h1-15,23H.
What are the key properties of 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate?
2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate has a molecular weight of 428.47 g/mol, XLogP of 6.02, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-phenyl 5-O-(9H-xanthen-9-yl) thiophene-2,5-dicarboxylate is sourced from PubChem (CID 143114506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).