C47H40F4O2 — CID 143114590
[4-[4-[bis(4-fluorophenyl)methyl]-3,5-difluorophenyl]phenyl] 2,7-ditert-butyl-9H-fluorene-9-carboxylate (PubChem CID 143114590) has the molecular formula C47H40F4O2 and a molecular weight of 712.83 g/mol. Its IUPAC name is [4-[4-[bis(4-fluorophenyl)methyl]-3,5-difluorophenyl]phenyl] 2,7-ditert-butyl-9H-fluorene-9-carboxylate.
| Compound Name | [4-[4-[bis(4-fluorophenyl)methyl]-3,5-difluorophenyl]phenyl] 2,7-ditert-butyl-9H-fluorene-9-carboxylate |
|---|---|
| PubChem CID | 143114590 |
| Molecular Formula | C47H40F4O2 |
| Molecular Weight | 712.83 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | [4-[4-[bis(4-fluorophenyl)methyl]-3,5-difluorophenyl]phenyl] 2,7-ditert-butyl-9H-fluorene-9-carboxylate |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C(=O)Oc1ccc(-c3cc(F)c(C(c4ccc(F)cc4)c4ccc(F)cc4)c(F)c3)cc1)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C47H40F4O2/c1-46(2,3)31-13-21-36-37-22-14-32(47(4,5)6)26-39(37)43(38(36)25-31)45(52)53-35-19-11-27(12-20-35)30-23-40(50)44(41(51)24-30)42(28-7-15-33(48)16-8-28)29-9-17-34(49)18-10-29/h7-26,42-43H,1-6H3 |
| InChIKey | ZTOMOYAMIZYYRU-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.83 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|