C19H18F3NO — CID 143114619
6-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 143114619) has the molecular formula C19H18F3NO and a molecular weight of 333.35 g/mol. Its IUPAC name is 6-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | 6-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 143114619 |
| Molecular Formula | C19H18F3NO |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 6-methyl-N-[[4-(trifluoromethyl)phenyl]methoxy]-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | Cc1ccc2c(c1)CCCC2=NOCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3NO/c1-13-5-10-17-15(11-13)3-2-4-18(17)23-24-12-14-6-8-16(9-7-14)19(20,21)22/h5-11H,2-4,12H2,1H3 |
| InChIKey | ILFDSBAOJRYSKN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|