C16H18O2 — CID 143114864
[3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methoxymethanol (PubChem CID 143114864) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methoxymethanol.
| Compound Name | [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methoxymethanol |
|---|---|
| PubChem CID | 143114864 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [3-ethenyl-2-[(Z)-prop-1-enyl]-1H-inden-1-yl]methoxymethanol |
| SMILES | C=CC1=C(/C=C\C)C(COCO)c2ccccc21 |
| InChI | InChI=1S/C16H18O2/c1-3-7-13-12(4-2)14-8-5-6-9-15(14)16(13)10-18-11-17/h3-9,16-17H,2,10-11H2,1H3/b7-3- |
| InChIKey | DZISQPBWJWMBIB-CLTKARDFSA-N |
| XLogP | 3.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|