About N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide
N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide (PubChem CID 1431151) has the molecular formula C12H13ClN2OS
and a molecular weight of 268.77 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide |
| PubChem CID | 1431151 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide |
| SMILES | CC(=O)N(C1=NCCCS1)c1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN2OS/c1-9(16)15(12-14-7-4-8-17-12)11-6-3-2-5-10(11)13/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | QXHPHABFCUSEOS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide?
The IUPAC name of N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide (CID 1431151) is N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide.
What is the SMILES notation for N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide?
The canonical SMILES for N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide is CC(=O)N(C1=NCCCS1)c1ccccc1Cl.
What is the InChIKey of N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide?
The InChIKey is QXHPHABFCUSEOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2OS/c1-9(16)15(12-14-7-4-8-17-12)11-6-3-2-5-10(11)13/h2-3,5-6H,4,7-8H2,1H3.
What are the key properties of N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide?
N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide has a molecular weight of 268.77 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-N-(5,6-dihydro-4H-1,3-thiazin-2-yl)acetamide is sourced from PubChem (CID 1431151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).