About ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline
ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline (PubChem CID 143115115) has the molecular formula C29H46N2O
and a molecular weight of 438.70 g/mol. Its IUPAC name is ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline.
Molecular Properties
| Compound Name | ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline |
| PubChem CID | 143115115 |
| Molecular Formula | C29H46N2O |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.36 |
| IUPAC Name | ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline |
| SMILES | CCN.CO.Cc1ccc(-c2ccc(C3CCC(C4CCC(C)CC4)CC3)cc2)cc1N |
| InChI | InChI=1S/C26H35N.C2H7N.CH4O/c1-18-3-6-20(7-4-18)21-9-11-22(12-10-21)23-13-15-24(16-14-23)25-8-5-19(2)26(27)17-25;1-2-3;1-2/h5,8,13-18,20-22H,3-4,6-7,9-12,27H2,1-2H3;2-3H2,1H3;2H,1H3 |
| InChIKey | VHYLNGIQDCKBIP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline?
The IUPAC name of ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline (CID 143115115) is ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline.
What is the SMILES notation for ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline?
The canonical SMILES for ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline is CCN.CO.Cc1ccc(-c2ccc(C3CCC(C4CCC(C)CC4)CC3)cc2)cc1N.
What is the InChIKey of ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline?
The InChIKey is VHYLNGIQDCKBIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35N.C2H7N.CH4O/c1-18-3-6-20(7-4-18)21-9-11-22(12-10-21)23-13-15-24(16-14-23)25-8-5-19(2)26(27)17-25;1-2-3;1-2/h5,8,13-18,20-22H,3-4,6-7,9-12,27H2,1-2H3;2-3H2,1H3;2H,1H3.
What are the key properties of ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline?
ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline has a molecular weight of 438.70 g/mol, XLogP of 6.92, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;methanol;2-methyl-5-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]aniline is sourced from PubChem (CID 143115115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).