C18H22N2 — CID 143115277
2-[(3E,5E,6Z)-5-ethylidenenona-1,3,6,8-tetraen-2-yl]-1-N-methylbenzene-1,4-diamine (PubChem CID 143115277) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[(3E,5E,6Z)-5-ethylidenenona-1,3,6,8-tetraen-2-yl]-1-N-methylbenzene-1,4-diamine.
| Compound Name | 2-[(3E,5E,6Z)-5-ethylidenenona-1,3,6,8-tetraen-2-yl]-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143115277 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2-[(3E,5E,6Z)-5-ethylidenenona-1,3,6,8-tetraen-2-yl]-1-N-methylbenzene-1,4-diamine |
| SMILES | C=C/C=C\C(\C=C\C(=C)c1cc(N)ccc1NC)=C/C |
| InChI | InChI=1S/C18H22N2/c1-5-7-8-15(6-2)10-9-14(3)17-13-16(19)11-12-18(17)20-4/h5-13,20H,1,3,19H2,2,4H3/b8-7-,10-9+,15-6+ |
| InChIKey | WHFKYBLJROBUQC-CRCAVJISSA-N |
| XLogP | 4.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|