About 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine
1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine (PubChem CID 143115310) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine.
Molecular Properties
| Compound Name | 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine |
| PubChem CID | 143115310 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine |
| SMILES | C/C=C\C(=C/C=C/CC)CN1CCN(C)CC1 |
| InChI | InChI=1S/C15H26N2/c1-4-6-7-9-15(8-5-2)14-17-12-10-16(3)11-13-17/h5-9H,4,10-14H2,1-3H3/b7-6+,8-5-,15-9+ |
| InChIKey | WXOFTPHESGYQBE-KFWCUIQDSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine?
The IUPAC name of 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine (CID 143115310) is 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine.
What is the SMILES notation for 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine?
The canonical SMILES for 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine is C/C=C\C(=C/C=C/CC)CN1CCN(C)CC1.
What is the InChIKey of 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine?
The InChIKey is WXOFTPHESGYQBE-KFWCUIQDSA-N. The full InChI is InChI=1S/C15H26N2/c1-4-6-7-9-15(8-5-2)14-17-12-10-16(3)11-13-17/h5-9H,4,10-14H2,1-3H3/b7-6+,8-5-,15-9+.
What are the key properties of 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine?
1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine has a molecular weight of 234.39 g/mol, XLogP of 2.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(2E,4E)-2-[(Z)-prop-1-enyl]hepta-2,4-dienyl]piperazine is sourced from PubChem (CID 143115310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).