About (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen
(4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen (PubChem CID 143115352) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen |
| PubChem CID | 143115352 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen |
| SMILES | C=C/C=C\C(CCNC)=N\C.[H][H] |
| InChI | InChI=1S/C9H16N2.H2/c1-4-5-6-9(11-3)7-8-10-2;/h4-6,10H,1,7-8H2,2-3H3;1H/b6-5-,11-9-; |
| InChIKey | JFVVIBZTPQTELL-XCHYLKOASA-N |
| XLogP | 1.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen?
The IUPAC name of (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen (CID 143115352) is (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen.
What is the SMILES notation for (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen?
The canonical SMILES for (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen is C=C/C=C\C(CCNC)=N\C.[H][H].
What is the InChIKey of (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen?
The InChIKey is JFVVIBZTPQTELL-XCHYLKOASA-N. The full InChI is InChI=1S/C9H16N2.H2/c1-4-5-6-9(11-3)7-8-10-2;/h4-6,10H,1,7-8H2,2-3H3;1H/b6-5-,11-9-;.
What are the key properties of (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen?
(4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen has a molecular weight of 154.26 g/mol, XLogP of 1.65, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-N-methyl-3-methyliminohepta-4,6-dien-1-amine;molecular hydrogen is sourced from PubChem (CID 143115352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).