C17H29NO — CID 143115661
(E)-4-[2-methylpropyl-[(2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]amino]but-2-en-2-ol (PubChem CID 143115661) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is (E)-4-[2-methylpropyl-[(2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]amino]but-2-en-2-ol.
| Compound Name | (E)-4-[2-methylpropyl-[(2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]amino]but-2-en-2-ol |
|---|---|
| PubChem CID | 143115661 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (E)-4-[2-methylpropyl-[(2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]amino]but-2-en-2-ol |
| SMILES | C/C=C\C=C(/C=C\C)CN(C/C=C(\C)O)CC(C)C |
| InChI | InChI=1S/C17H29NO/c1-6-8-10-17(9-7-2)14-18(13-15(3)4)12-11-16(5)19/h6-11,15,19H,12-14H2,1-5H3/b8-6-,9-7-,16-11+,17-10+ |
| InChIKey | IZHWPSVUUCAVLE-CTXBFSIHSA-N |
| XLogP | 4.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|