C33H28Cl2N2O3 — CID 143115917
(2E,4E)-6-[4-(2,4-dichlorophenyl)-2-methylimidazol-1-yl]-2-ethenyl-5-methylhexa-2,4-dienoic acid;4-(4-ethynylphenyl)phenol (PubChem CID 143115917) has the molecular formula C33H28Cl2N2O3 and a molecular weight of 571.50 g/mol. Its IUPAC name is (2E,4E)-6-[4-(2,4-dichlorophenyl)-2-methylimidazol-1-yl]-2-ethenyl-5-methylhexa-2,4-dienoic acid;4-(4-ethynylphenyl)phenol.
| Compound Name | (2E,4E)-6-[4-(2,4-dichlorophenyl)-2-methylimidazol-1-yl]-2-ethenyl-5-methylhexa-2,4-dienoic acid;4-(4-ethynylphenyl)phenol |
|---|---|
| PubChem CID | 143115917 |
| Molecular Formula | C33H28Cl2N2O3 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | (2E,4E)-6-[4-(2,4-dichlorophenyl)-2-methylimidazol-1-yl]-2-ethenyl-5-methylhexa-2,4-dienoic acid;4-(4-ethynylphenyl)phenol |
| SMILES | C#Cc1ccc(-c2ccc(O)cc2)cc1.C=C/C(=C\C=C(/C)Cn1cc(-c2ccc(Cl)cc2Cl)nc1C)C(=O)O |
| InChI | InChI=1S/C19H18Cl2N2O2.C14H10O/c1-4-14(19(24)25)6-5-12(2)10-23-11-18(22-13(23)3)16-8-7-15(20)9-17(16)21;1-2-11-3-5-12(6-4-11)13-7-9-14(15)10-8-13/h4-9,11H,1,10H2,2-3H3,(H,24,25);1,3-10,15H/b12-5+,14-6+; |
| InChIKey | VJCMUNVYQCVXMX-DRJZYXLPSA-N |
| XLogP | 8.35 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|