About 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine
2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine (PubChem CID 143116457) has the molecular formula C22H32ClN3O
and a molecular weight of 389.97 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine |
| PubChem CID | 143116457 |
| Molecular Formula | C22H32ClN3O |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine |
| SMILES | CC.Cc1ccc(C(=O)NCC2CCNC(C)C2)c(Cl)c1.c1ccncc1 |
| InChI | InChI=1S/C15H21ClN2O.C5H5N.C2H6/c1-10-3-4-13(14(16)7-10)15(19)18-9-12-5-6-17-11(2)8-12;1-2-4-6-5-3-1;1-2/h3-4,7,11-12,17H,5-6,8-9H2,1-2H3,(H,18,19);1-5H;1-2H3 |
| InChIKey | BNZYWNNAYBLSPG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine?
The IUPAC name of 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine (CID 143116457) is 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine.
What is the SMILES notation for 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine?
The canonical SMILES for 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine is CC.Cc1ccc(C(=O)NCC2CCNC(C)C2)c(Cl)c1.c1ccncc1.
What is the InChIKey of 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine?
The InChIKey is BNZYWNNAYBLSPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClN2O.C5H5N.C2H6/c1-10-3-4-13(14(16)7-10)15(19)18-9-12-5-6-17-11(2)8-12;1-2-4-6-5-3-1;1-2/h3-4,7,11-12,17H,5-6,8-9H2,1-2H3,(H,18,19);1-5H;1-2H3.
What are the key properties of 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine?
2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine has a molecular weight of 389.97 g/mol, XLogP of 4.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-N-[(2-methylpiperidin-4-yl)methyl]benzamide;ethane;pyridine is sourced from PubChem (CID 143116457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).