C17H27N2O2+ — CID 143116705
ethyl 1-(cyclohexylmethyl)-4,5,6,7-tetrahydro-2H-indazol-1-ium-3-carboxylate (PubChem CID 143116705) has the molecular formula C17H27N2O2+ and a molecular weight of 291.41 g/mol. Its IUPAC name is ethyl 1-(cyclohexylmethyl)-4,5,6,7-tetrahydro-2H-indazol-1-ium-3-carboxylate.
| Compound Name | ethyl 1-(cyclohexylmethyl)-4,5,6,7-tetrahydro-2H-indazol-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 143116705 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | ethyl 1-(cyclohexylmethyl)-4,5,6,7-tetrahydro-2H-indazol-1-ium-3-carboxylate |
| SMILES | CCOC(=O)c1[nH][n+](CC2CCCCC2)c2c1CCCC2 |
| InChI | InChI=1S/C17H26N2O2/c1-2-21-17(20)16-14-10-6-7-11-15(14)19(18-16)12-13-8-4-3-5-9-13/h13H,2-12H2,1H3/p+1 |
| InChIKey | JSSZQPRPHOITGO-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|