About butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate
butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate (PubChem CID 143116712) has the molecular formula C20H38N2O2
and a molecular weight of 338.54 g/mol. Its IUPAC name is butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate.
Molecular Properties
| Compound Name | butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate |
| PubChem CID | 143116712 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate |
| SMILES | CC.CCCC.CCOC(=O)c1cc(CC)n(C2CCCCC2)n1 |
| InChI | InChI=1S/C14H22N2O2.C4H10.C2H6/c1-3-11-10-13(14(17)18-4-2)15-16(11)12-8-6-5-7-9-12;1-3-4-2;1-2/h10,12H,3-9H2,1-2H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | XRXMLFOTNHOHAR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate?
The IUPAC name of butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate (CID 143116712) is butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate.
What is the SMILES notation for butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate?
The canonical SMILES for butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate is CC.CCCC.CCOC(=O)c1cc(CC)n(C2CCCCC2)n1.
What is the InChIKey of butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate?
The InChIKey is XRXMLFOTNHOHAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2.C4H10.C2H6/c1-3-11-10-13(14(17)18-4-2)15-16(11)12-8-6-5-7-9-12;1-3-4-2;1-2/h10,12H,3-9H2,1-2H3;3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate?
butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate has a molecular weight of 338.54 g/mol, XLogP of 5.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;ethyl 1-cyclohexyl-5-ethylpyrazole-3-carboxylate is sourced from PubChem (CID 143116712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).