About 3,4-dimethylpent-3-en-2-imine;ethane
3,4-dimethylpent-3-en-2-imine;ethane (PubChem CID 143116875) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 3,4-dimethylpent-3-en-2-imine;ethane.
Molecular Properties
| Compound Name | 3,4-dimethylpent-3-en-2-imine;ethane |
| PubChem CID | 143116875 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 3,4-dimethylpent-3-en-2-imine;ethane |
| SMILES | CC.[H]/N=C(\C)C(C)=C(C)C |
| InChI | InChI=1S/C7H13N.C2H6/c1-5(2)6(3)7(4)8;1-2/h8H,1-4H3;1-2H3/b8-7+; |
| InChIKey | JTLFSHLLKGSSET-USRGLUTNSA-N |
| XLogP | 3.41 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylpent-3-en-2-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylpent-3-en-2-imine;ethane?
The IUPAC name of 3,4-dimethylpent-3-en-2-imine;ethane (CID 143116875) is 3,4-dimethylpent-3-en-2-imine;ethane.
What is the SMILES notation for 3,4-dimethylpent-3-en-2-imine;ethane?
The canonical SMILES for 3,4-dimethylpent-3-en-2-imine;ethane is CC.[H]/N=C(\C)C(C)=C(C)C.
What is the InChIKey of 3,4-dimethylpent-3-en-2-imine;ethane?
The InChIKey is JTLFSHLLKGSSET-USRGLUTNSA-N. The full InChI is InChI=1S/C7H13N.C2H6/c1-5(2)6(3)7(4)8;1-2/h8H,1-4H3;1-2H3/b8-7+;.
What are the key properties of 3,4-dimethylpent-3-en-2-imine;ethane?
3,4-dimethylpent-3-en-2-imine;ethane has a molecular weight of 141.26 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylpent-3-en-2-imine;ethane is sourced from PubChem (CID 143116875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).