About piperidine-1,3-dicarbaldehyde
piperidine-1,3-dicarbaldehyde (PubChem CID 143116896) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is piperidine-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | piperidine-1,3-dicarbaldehyde |
| PubChem CID | 143116896 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | piperidine-1,3-dicarbaldehyde |
| SMILES | O=CC1CCCN(C=O)C1 |
| InChI | InChI=1S/C7H11NO2/c9-5-7-2-1-3-8(4-7)6-10/h5-7H,1-4H2 |
| InChIKey | QQSPGFVVIUEESO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze piperidine-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-1,3-dicarbaldehyde?
The IUPAC name of piperidine-1,3-dicarbaldehyde (CID 143116896) is piperidine-1,3-dicarbaldehyde.
What is the SMILES notation for piperidine-1,3-dicarbaldehyde?
The canonical SMILES for piperidine-1,3-dicarbaldehyde is O=CC1CCCN(C=O)C1.
What is the InChIKey of piperidine-1,3-dicarbaldehyde?
The InChIKey is QQSPGFVVIUEESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c9-5-7-2-1-3-8(4-7)6-10/h5-7H,1-4H2.
What are the key properties of piperidine-1,3-dicarbaldehyde?
piperidine-1,3-dicarbaldehyde has a molecular weight of 141.17 g/mol, XLogP of 0.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1,3-dicarbaldehyde is sourced from PubChem (CID 143116896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).