About N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide
N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide (PubChem CID 143117045) has the molecular formula C12H21BrN2O
and a molecular weight of 289.22 g/mol. Its IUPAC name is N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide |
| PubChem CID | 143117045 |
| Molecular Formula | C12H21BrN2O |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide |
| SMILES | C/C=C(\C=C(/C)Br)CNCCCNC(C)=O |
| InChI | InChI=1S/C12H21BrN2O/c1-4-12(8-10(2)13)9-14-6-5-7-15-11(3)16/h4,8,14H,5-7,9H2,1-3H3,(H,15,16)/b10-8+,12-4+ |
| InChIKey | CKPIKKBBICANEI-YNBPMFSMSA-N |
| XLogP | 2.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide?
The IUPAC name of N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide (CID 143117045) is N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide.
What is the SMILES notation for N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide?
The canonical SMILES for N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide is C/C=C(\C=C(/C)Br)CNCCCNC(C)=O.
What is the InChIKey of N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide?
The InChIKey is CKPIKKBBICANEI-YNBPMFSMSA-N. The full InChI is InChI=1S/C12H21BrN2O/c1-4-12(8-10(2)13)9-14-6-5-7-15-11(3)16/h4,8,14H,5-7,9H2,1-3H3,(H,15,16)/b10-8+,12-4+.
What are the key properties of N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide?
N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide has a molecular weight of 289.22 g/mol, XLogP of 2.35, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[(E,2E)-4-bromo-2-ethylidenepent-3-enyl]amino]propyl]acetamide is sourced from PubChem (CID 143117045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).