C23H30N4O — CID 143117822
N-[(E)-N-[3-ethenyl-1-(2,4,5-trimethylphenyl)pyrazol-5-yl]-C-methylcarbonimidoyl]cyclohexanecarboxamide (PubChem CID 143117822) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[(E)-N-[3-ethenyl-1-(2,4,5-trimethylphenyl)pyrazol-5-yl]-C-methylcarbonimidoyl]cyclohexanecarboxamide.
| Compound Name | N-[(E)-N-[3-ethenyl-1-(2,4,5-trimethylphenyl)pyrazol-5-yl]-C-methylcarbonimidoyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 143117822 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-[(E)-N-[3-ethenyl-1-(2,4,5-trimethylphenyl)pyrazol-5-yl]-C-methylcarbonimidoyl]cyclohexanecarboxamide |
| SMILES | C=Cc1cc(/N=C(\C)NC(=O)C2CCCCC2)n(-c2cc(C)c(C)cc2C)n1 |
| InChI | InChI=1S/C23H30N4O/c1-6-20-14-22(24-18(5)25-23(28)19-10-8-7-9-11-19)27(26-20)21-13-16(3)15(2)12-17(21)4/h6,12-14,19H,1,7-11H2,2-5H3,(H,24,25,28) |
| InChIKey | SVPOYHXKKSKVAS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|