C20H30N2 — CID 143118466
(Z)-3-ethenyl-N-(2-phenylethyl)-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine (PubChem CID 143118466) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (Z)-3-ethenyl-N-(2-phenylethyl)-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine.
| Compound Name | (Z)-3-ethenyl-N-(2-phenylethyl)-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 143118466 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (Z)-3-ethenyl-N-(2-phenylethyl)-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine |
| SMILES | C=C/C(=C\C)CCN(CCc1ccccc1)C[C@@H]1CCCN1 |
| InChI | InChI=1S/C20H30N2/c1-3-18(4-2)12-15-22(17-20-11-8-14-21-20)16-13-19-9-6-5-7-10-19/h3-7,9-10,20-21H,1,8,11-17H2,2H3/b18-4+/t20-/m0/s1 |
| InChIKey | WJJOBJIKURNBEX-VXQLYJCQSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|