C9H16O8 — CID 14311862
(2S,4R,6R)-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 14311862) has the molecular formula C9H16O8 and a molecular weight of 252.22 g/mol. Its IUPAC name is (2S,4R,6R)-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,4R,6R)-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 14311862 |
| Molecular Formula | C9H16O8 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (2S,4R,6R)-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)C[C@H](O)C[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C9H16O8/c10-3-5(12)7(13)6-1-4(11)2-9(16,17-6)8(14)15/h4-7,10-13,16H,1-3H2,(H,14,15)/t4-,5-,6-,7-,9+/m1/s1 |
| InChIKey | MTINJFBMGGVKEV-BTPGUECKSA-N |
| XLogP | -2.99 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |