C22H31F3N10O2 — CID 143119017
6-(2-morpholin-4-ylethanimidoyl)-2-piperazin-1-yl-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine (PubChem CID 143119017) has the molecular formula C22H31F3N10O2 and a molecular weight of 524.55 g/mol. Its IUPAC name is 6-(2-morpholin-4-ylethanimidoyl)-2-piperazin-1-yl-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine.
| Compound Name | 6-(2-morpholin-4-ylethanimidoyl)-2-piperazin-1-yl-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143119017 |
| Molecular Formula | C22H31F3N10O2 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 6-(2-morpholin-4-ylethanimidoyl)-2-piperazin-1-yl-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine |
| SMILES | [H]/N=C(\CN1CCOCC1)c1nc(N2CCNCC2)nc(Nc2ccncn2)c1NCCOCC(F)(F)F |
| InChI | InChI=1S/C22H31F3N10O2/c23-22(24,25)14-37-10-5-29-19-18(16(26)13-34-8-11-36-12-9-34)32-21(35-6-3-27-4-7-35)33-20(19)31-17-1-2-28-15-30-17/h1-2,15,26-27,29H,3-14H2,(H,28,30,31,32,33)/b26-16+ |
| InChIKey | IIHCYOGBAAXVHL-WGOQTCKBSA-N |
| XLogP | 1.11 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|