C22H32F3N11O — CID 143119029
2-piperazin-1-yl-6-(2-piperazin-1-ylethanimidoyl)-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine (PubChem CID 143119029) has the molecular formula C22H32F3N11O and a molecular weight of 523.57 g/mol. Its IUPAC name is 2-piperazin-1-yl-6-(2-piperazin-1-ylethanimidoyl)-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine.
| Compound Name | 2-piperazin-1-yl-6-(2-piperazin-1-ylethanimidoyl)-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143119029 |
| Molecular Formula | C22H32F3N11O |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 2-piperazin-1-yl-6-(2-piperazin-1-ylethanimidoyl)-4-N-pyrimidin-4-yl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-4,5-diamine |
| SMILES | [H]/N=C(\CN1CCNCC1)c1nc(N2CCNCC2)nc(Nc2ccncn2)c1NCCOCC(F)(F)F |
| InChI | InChI=1S/C22H32F3N11O/c23-22(24,25)14-37-12-7-30-19-18(16(26)13-35-8-3-27-4-9-35)33-21(36-10-5-28-6-11-36)34-20(19)32-17-1-2-29-15-31-17/h1-2,15,26-28,30H,3-14H2,(H,29,31,32,33,34)/b26-16+ |
| InChIKey | MHLOPXAAXTYNDA-WGOQTCKBSA-N |
| XLogP | 0.68 |
| TPSA | 139.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|