About 1,4-difluorocyclohepta-1,3,5-triene
1,4-difluorocyclohepta-1,3,5-triene (PubChem CID 143120716) has the molecular formula C7H6F2
and a molecular weight of 128.12 g/mol. Its IUPAC name is 1,4-difluorocyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 1,4-difluorocyclohepta-1,3,5-triene |
| PubChem CID | 143120716 |
| Molecular Formula | C7H6F2 |
| Molecular Weight | 128.12 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 1,4-difluorocyclohepta-1,3,5-triene |
| SMILES | FC1=CC=C(F)CC=C1 |
| InChI | InChI=1S/C7H6F2/c8-6-2-1-3-7(9)5-4-6/h1-2,4-5H,3H2 |
| InChIKey | VGEDEFKDPAMSKB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-difluorocyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-difluorocyclohepta-1,3,5-triene?
The IUPAC name of 1,4-difluorocyclohepta-1,3,5-triene (CID 143120716) is 1,4-difluorocyclohepta-1,3,5-triene.
What is the SMILES notation for 1,4-difluorocyclohepta-1,3,5-triene?
The canonical SMILES for 1,4-difluorocyclohepta-1,3,5-triene is FC1=CC=C(F)CC=C1.
What is the InChIKey of 1,4-difluorocyclohepta-1,3,5-triene?
The InChIKey is VGEDEFKDPAMSKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2/c8-6-2-1-3-7(9)5-4-6/h1-2,4-5H,3H2.
What are the key properties of 1,4-difluorocyclohepta-1,3,5-triene?
1,4-difluorocyclohepta-1,3,5-triene has a molecular weight of 128.12 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-difluorocyclohepta-1,3,5-triene is sourced from PubChem (CID 143120716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).