C25H32N4O — CID 143121616
2-[2-amino-4-(2,6-dimethylphenyl)-6-methylphenyl]-1-(4-ethoxycyclohepta-1,3-dien-1-yl)guanidine (PubChem CID 143121616) has the molecular formula C25H32N4O and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-[2-amino-4-(2,6-dimethylphenyl)-6-methylphenyl]-1-(4-ethoxycyclohepta-1,3-dien-1-yl)guanidine.
| Compound Name | 2-[2-amino-4-(2,6-dimethylphenyl)-6-methylphenyl]-1-(4-ethoxycyclohepta-1,3-dien-1-yl)guanidine |
|---|---|
| PubChem CID | 143121616 |
| Molecular Formula | C25H32N4O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 2-[2-amino-4-(2,6-dimethylphenyl)-6-methylphenyl]-1-(4-ethoxycyclohepta-1,3-dien-1-yl)guanidine |
| SMILES | CCOC1=CC=C(N/C(N)=N/c2c(C)cc(-c3c(C)cccc3C)cc2N)CCC1 |
| InChI | InChI=1S/C25H32N4O/c1-5-30-21-11-7-10-20(12-13-21)28-25(27)29-24-18(4)14-19(15-22(24)26)23-16(2)8-6-9-17(23)3/h6,8-9,12-15H,5,7,10-11,26H2,1-4H3,(H3,27,28,29) |
| InChIKey | NQDFGJIXFUNROH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|