About N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane
N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane (PubChem CID 143122796) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane.
Molecular Properties
| Compound Name | N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane |
| PubChem CID | 143122796 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane |
| SMILES | C.CCCN(CC)C1=CCC(C)C=C1 |
| InChI | InChI=1S/C12H21N.CH4/c1-4-10-13(5-2)12-8-6-11(3)7-9-12;/h6,8-9,11H,4-5,7,10H2,1-3H3;1H4 |
| InChIKey | UUXNLMYBUGIYSF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane?
The IUPAC name of N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane (CID 143122796) is N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane.
What is the SMILES notation for N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane?
The canonical SMILES for N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane is C.CCCN(CC)C1=CCC(C)C=C1.
What is the InChIKey of N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane?
The InChIKey is UUXNLMYBUGIYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.CH4/c1-4-10-13(5-2)12-8-6-11(3)7-9-12;/h6,8-9,11H,4-5,7,10H2,1-3H3;1H4.
What are the key properties of N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane?
N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane has a molecular weight of 195.35 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-methyl-N-propylcyclohexa-1,5-dien-1-amine;methane is sourced from PubChem (CID 143122796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).