C11H16N2 — CID 143122841
1-(1,2-dihydropyridin-4-yl)-2,3,6,7-tetrahydroazepine (PubChem CID 143122841) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-(1,2-dihydropyridin-4-yl)-2,3,6,7-tetrahydroazepine.
| Compound Name | 1-(1,2-dihydropyridin-4-yl)-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 143122841 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-(1,2-dihydropyridin-4-yl)-2,3,6,7-tetrahydroazepine |
| SMILES | C1=CCCN(C2=CCNC=C2)CC1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-10-13(9-3-1)11-5-7-12-8-6-11/h1-2,5-7,12H,3-4,8-10H2 |
| InChIKey | QEDOFGKFJCABFF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|