C16H28O4 — CID 143123097
2-methoxy-2-[(3E,5E)-8-methoxy-6-(methoxymethyl)octa-3,5-dien-4-yl]-3,3-dimethyloxirane (PubChem CID 143123097) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-methoxy-2-[(3E,5E)-8-methoxy-6-(methoxymethyl)octa-3,5-dien-4-yl]-3,3-dimethyloxirane.
| Compound Name | 2-methoxy-2-[(3E,5E)-8-methoxy-6-(methoxymethyl)octa-3,5-dien-4-yl]-3,3-dimethyloxirane |
|---|---|
| PubChem CID | 143123097 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-methoxy-2-[(3E,5E)-8-methoxy-6-(methoxymethyl)octa-3,5-dien-4-yl]-3,3-dimethyloxirane |
| SMILES | CC/C=C(\C=C(/CCOC)COC)C1(OC)OC1(C)C |
| InChI | InChI=1S/C16H28O4/c1-7-8-14(16(19-6)15(2,3)20-16)11-13(12-18-5)9-10-17-4/h8,11H,7,9-10,12H2,1-6H3/b13-11+,14-8+ |
| InChIKey | HOTBBPXPMCNGCO-BCMCLHILSA-N |
| XLogP | 3.08 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|