About 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine
4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine (PubChem CID 143123514) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine.
Molecular Properties
| Compound Name | 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine |
| PubChem CID | 143123514 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine |
| SMILES | CN1CCSC2=C1CC=CC=C2 |
| InChI | InChI=1S/C10H13NS/c1-11-7-8-12-10-6-4-2-3-5-9(10)11/h2-4,6H,5,7-8H2,1H3 |
| InChIKey | FVTNIBUTQNATKW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine?
The IUPAC name of 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine (CID 143123514) is 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine.
What is the SMILES notation for 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine?
The canonical SMILES for 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine is CN1CCSC2=C1CC=CC=C2.
What is the InChIKey of 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine?
The InChIKey is FVTNIBUTQNATKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-11-7-8-12-10-6-4-2-3-5-9(10)11/h2-4,6H,5,7-8H2,1H3.
What are the key properties of 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine?
4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine has a molecular weight of 179.29 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,5-dihydro-2H-cyclohepta[b][1,4]thiazine is sourced from PubChem (CID 143123514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).