C46H46BN — CID 143123585
[4-(4-carbazol-9-ylphenyl)-2,3,5,6-tetramethylphenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 143123585) has the molecular formula C46H46BN and a molecular weight of 623.69 g/mol. Its IUPAC name is [4-(4-carbazol-9-ylphenyl)-2,3,5,6-tetramethylphenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-(4-carbazol-9-ylphenyl)-2,3,5,6-tetramethylphenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 143123585 |
| Molecular Formula | C46H46BN |
| Molecular Weight | 623.69 g/mol |
| Exact Mass | 623.37 |
| IUPAC Name | [4-(4-carbazol-9-ylphenyl)-2,3,5,6-tetramethylphenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2c(C)c(C)c(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)c(C)c2C)c(C)c1 |
| InChI | InChI=1S/C46H46BN/c1-27-23-29(3)44(30(4)24-27)47(45-31(5)25-28(2)26-32(45)6)46-35(9)33(7)43(34(8)36(46)10)37-19-21-38(22-20-37)48-41-17-13-11-15-39(41)40-16-12-14-18-42(40)48/h11-26H,1-10H3 |
| InChIKey | NXRMIACBEHXFOV-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.69 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|