About ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate
ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate (PubChem CID 143123954) has the molecular formula C27H33NO4S
and a molecular weight of 467.63 g/mol. Its IUPAC name is ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate |
| PubChem CID | 143123954 |
| Molecular Formula | C27H33NO4S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate |
| SMILES | CC.CC(C)OC(=O)CN(C)CCOc1ccc(-c2ccccc2)cc1C(=O)c1cccs1 |
| InChI | InChI=1S/C25H27NO4S.C2H6/c1-18(2)30-24(27)17-26(3)13-14-29-22-12-11-20(19-8-5-4-6-9-19)16-21(22)25(28)23-10-7-15-31-23;1-2/h4-12,15-16,18H,13-14,17H2,1-3H3;1-2H3 |
| InChIKey | MOOMTBWSBOJEOL-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate?
The IUPAC name of ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate (CID 143123954) is ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate.
What is the SMILES notation for ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate?
The canonical SMILES for ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate is CC.CC(C)OC(=O)CN(C)CCOc1ccc(-c2ccccc2)cc1C(=O)c1cccs1.
What is the InChIKey of ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate?
The InChIKey is MOOMTBWSBOJEOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO4S.C2H6/c1-18(2)30-24(27)17-26(3)13-14-29-22-12-11-20(19-8-5-4-6-9-19)16-21(22)25(28)23-10-7-15-31-23;1-2/h4-12,15-16,18H,13-14,17H2,1-3H3;1-2H3.
What are the key properties of ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate?
ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate has a molecular weight of 467.63 g/mol, XLogP of 5.93, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 2-[methyl-[2-[4-phenyl-2-(thiophene-2-carbonyl)phenoxy]ethyl]amino]acetate is sourced from PubChem (CID 143123954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).