About ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate
ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate (PubChem CID 143123959) has the molecular formula C26H40NO3P
and a molecular weight of 445.58 g/mol. Its IUPAC name is ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate.
Molecular Properties
| Compound Name | ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate |
| PubChem CID | 143123959 |
| Molecular Formula | C26H40NO3P |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate |
| SMILES | CC.CC(C)OC(=O)CN(C)CCOc1ccc(-c2ccccc2P)cc1C(C)(C)C |
| InChI | InChI=1S/C24H34NO3P.C2H6/c1-17(2)28-23(26)16-25(6)13-14-27-21-12-11-18(15-20(21)24(3,4)5)19-9-7-8-10-22(19)29;1-2/h7-12,15,17H,13-14,16,29H2,1-6H3;1-2H3 |
| InChIKey | XICCIXQUPNAVML-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate?
The IUPAC name of ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate (CID 143123959) is ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate.
What is the SMILES notation for ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate?
The canonical SMILES for ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate is CC.CC(C)OC(=O)CN(C)CCOc1ccc(-c2ccccc2P)cc1C(C)(C)C.
What is the InChIKey of ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate?
The InChIKey is XICCIXQUPNAVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34NO3P.C2H6/c1-17(2)28-23(26)16-25(6)13-14-27-21-12-11-18(15-20(21)24(3,4)5)19-9-7-8-10-22(19)29;1-2/h7-12,15,17H,13-14,16,29H2,1-6H3;1-2H3.
What are the key properties of ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate?
ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate has a molecular weight of 445.58 g/mol, XLogP of 5.44, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl 2-[2-[2-tert-butyl-4-(2-phosphanylphenyl)phenoxy]ethyl-methylamino]acetate is sourced from PubChem (CID 143123959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).