About ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane
ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane (PubChem CID 143124054) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane.
Molecular Properties
| Compound Name | ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane |
| PubChem CID | 143124054 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane |
| SMILES | CC.CCC.CSCC(=O)N1CCOC1=O |
| InChI | InChI=1S/C6H9NO3S.C3H8.C2H6/c1-11-4-5(8)7-2-3-10-6(7)9;1-3-2;1-2/h2-4H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | SEEXHMUZAJNOHK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane?
The IUPAC name of ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane (CID 143124054) is ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane.
What is the SMILES notation for ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane?
The canonical SMILES for ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane is CC.CCC.CSCC(=O)N1CCOC1=O.
What is the InChIKey of ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane?
The InChIKey is SEEXHMUZAJNOHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3S.C3H8.C2H6/c1-11-4-5(8)7-2-3-10-6(7)9;1-3-2;1-2/h2-4H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane?
ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane has a molecular weight of 249.38 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(2-methylsulfanylacetyl)-1,3-oxazolidin-2-one;propane is sourced from PubChem (CID 143124054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).