About ethane;(Z)-N'-ethylbut-2-enimidamide
ethane;(Z)-N'-ethylbut-2-enimidamide (PubChem CID 143124764) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is ethane;(Z)-N'-ethylbut-2-enimidamide.
Molecular Properties
| Compound Name | ethane;(Z)-N'-ethylbut-2-enimidamide |
| PubChem CID | 143124764 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | ethane;(Z)-N'-ethylbut-2-enimidamide |
| SMILES | C/C=C\C(N)=N\CC.CC |
| InChI | InChI=1S/C6H12N2.C2H6/c1-3-5-6(7)8-4-2;1-2/h3,5H,4H2,1-2H3,(H2,7,8);1-2H3/b5-3-; |
| InChIKey | IQTFANRBMQPRRW-FBZPGIPVSA-N |
| XLogP | 1.97 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-N'-ethylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-N'-ethylbut-2-enimidamide?
The IUPAC name of ethane;(Z)-N'-ethylbut-2-enimidamide (CID 143124764) is ethane;(Z)-N'-ethylbut-2-enimidamide.
What is the SMILES notation for ethane;(Z)-N'-ethylbut-2-enimidamide?
The canonical SMILES for ethane;(Z)-N'-ethylbut-2-enimidamide is C/C=C\C(N)=N\CC.CC.
What is the InChIKey of ethane;(Z)-N'-ethylbut-2-enimidamide?
The InChIKey is IQTFANRBMQPRRW-FBZPGIPVSA-N. The full InChI is InChI=1S/C6H12N2.C2H6/c1-3-5-6(7)8-4-2;1-2/h3,5H,4H2,1-2H3,(H2,7,8);1-2H3/b5-3-;.
What are the key properties of ethane;(Z)-N'-ethylbut-2-enimidamide?
ethane;(Z)-N'-ethylbut-2-enimidamide has a molecular weight of 142.25 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-N'-ethylbut-2-enimidamide is sourced from PubChem (CID 143124764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).