About (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid
(2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid (PubChem CID 143124965) has the molecular formula C12H11NO2
and a molecular weight of 201.22 g/mol. Its IUPAC name is (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid |
| PubChem CID | 143124965 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid |
| SMILES | C=C/C=c1/c(C(=O)O)ccn/c1=C/C=C |
| InChI | InChI=1S/C12H11NO2/c1-3-5-9-10(12(14)15)7-8-13-11(9)6-4-2/h3-8H,1-2H2,(H,14,15)/b9-5-,11-6+ |
| InChIKey | DLZGMKVPTLTEII-YCQMDOFOSA-N |
| XLogP | 0.71 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid?
The IUPAC name of (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid (CID 143124965) is (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid.
What is the SMILES notation for (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid?
The canonical SMILES for (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid is C=C/C=c1/c(C(=O)O)ccn/c1=C/C=C.
What is the InChIKey of (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid?
The InChIKey is DLZGMKVPTLTEII-YCQMDOFOSA-N. The full InChI is InChI=1S/C12H11NO2/c1-3-5-9-10(12(14)15)7-8-13-11(9)6-4-2/h3-8H,1-2H2,(H,14,15)/b9-5-,11-6+.
What are the key properties of (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid?
(2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid has a molecular weight of 201.22 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2,3-bis(prop-2-enylidene)pyridine-4-carboxylic acid is sourced from PubChem (CID 143124965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).