C24H35NO4 — CID 143125345
(4S)-3-acetyl-4-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3-oxazolidin-2-one;(3Z,6E)-6-(ethoxymethyl)octa-1,3,6-triene (PubChem CID 143125345) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is (4S)-3-acetyl-4-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3-oxazolidin-2-one;(3Z,6E)-6-(ethoxymethyl)octa-1,3,6-triene.
| Compound Name | (4S)-3-acetyl-4-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3-oxazolidin-2-one;(3Z,6E)-6-(ethoxymethyl)octa-1,3,6-triene |
|---|---|
| PubChem CID | 143125345 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | (4S)-3-acetyl-4-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1,3-oxazolidin-2-one;(3Z,6E)-6-(ethoxymethyl)octa-1,3,6-triene |
| SMILES | C=C/C=C(\C=C/C)C[C@H]1COC(=O)N1C(C)=O.C=C/C=C\C/C(=C\C)COCC |
| InChI | InChI=1S/C13H17NO3.C11H18O/c1-4-6-11(7-5-2)8-12-9-17-13(16)14(12)10(3)15;1-4-7-8-9-11(5-2)10-12-6-3/h4-7,12H,1,8-9H2,2-3H3;4-5,7-8H,1,6,9-10H2,2-3H3/b7-5-,11-6+;8-7-,11-5+/t12-;/m0./s1 |
| InChIKey | VHVFWUIFANYARL-OOCLVHEJSA-N |
| XLogP | 5.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|