C12H16N2O3S — CID 143125430
4-(propoxymethyl)-5-(1,3-thiazol-2-yl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid (PubChem CID 143125430) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-(propoxymethyl)-5-(1,3-thiazol-2-yl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(propoxymethyl)-5-(1,3-thiazol-2-yl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 143125430 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-(propoxymethyl)-5-(1,3-thiazol-2-yl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid |
| SMILES | CCCOCC1=CC(C(=O)O)NC1c1nccs1 |
| InChI | InChI=1S/C12H16N2O3S/c1-2-4-17-7-8-6-9(12(15)16)14-10(8)11-13-3-5-18-11/h3,5-6,9-10,14H,2,4,7H2,1H3,(H,15,16) |
| InChIKey | CXECICDZHMUVMR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|