About ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate
ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate (PubChem CID 143126931) has the molecular formula C14H22O7
and a molecular weight of 302.32 g/mol. Its IUPAC name is ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate |
| PubChem CID | 143126931 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate |
| SMILES | CC.COC(=O)CCC(=O)OCC(O)C1C=C(O)C(=O)C1 |
| InChI | InChI=1S/C12H16O7.C2H6/c1-18-11(16)2-3-12(17)19-6-10(15)7-4-8(13)9(14)5-7;1-2/h4,7,10,13,15H,2-3,5-6H2,1H3;1-2H3 |
| InChIKey | BHTVWEPLWYUFAP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate?
The IUPAC name of ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate (CID 143126931) is ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate.
What is the SMILES notation for ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate?
The canonical SMILES for ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate is CC.COC(=O)CCC(=O)OCC(O)C1C=C(O)C(=O)C1.
What is the InChIKey of ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate?
The InChIKey is BHTVWEPLWYUFAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O7.C2H6/c1-18-11(16)2-3-12(17)19-6-10(15)7-4-8(13)9(14)5-7;1-2/h4,7,10,13,15H,2-3,5-6H2,1H3;1-2H3.
What are the key properties of ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate?
ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate has a molecular weight of 302.32 g/mol, XLogP of 0.90, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-O-[2-hydroxy-2-(3-hydroxy-4-oxocyclopent-2-en-1-yl)ethyl] 1-O-methyl butanedioate is sourced from PubChem (CID 143126931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).