C13H22BrN3 — CID 143127002
1-(5-bromo-2-pyridinyl)-N,N-dimethylpyrrolidin-3-amine;ethane (PubChem CID 143127002) has the molecular formula C13H22BrN3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-N,N-dimethylpyrrolidin-3-amine;ethane.
| Compound Name | 1-(5-bromo-2-pyridinyl)-N,N-dimethylpyrrolidin-3-amine;ethane |
|---|---|
| PubChem CID | 143127002 |
| Molecular Formula | C13H22BrN3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-N,N-dimethylpyrrolidin-3-amine;ethane |
| SMILES | CC.CN(C)C1CCN(c2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C11H16BrN3.C2H6/c1-14(2)10-5-6-15(8-10)11-4-3-9(12)7-13-11;1-2/h3-4,7,10H,5-6,8H2,1-2H3;1-2H3 |
| InChIKey | JISNHSLGCJYVMK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |