C24H21N5O2 — CID 143127287
2-[3-[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]-5-[(2R)-2-ethynylpyrrolidine-1-carbonyl]phenyl]benzonitrile (PubChem CID 143127287) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-[3-[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]-5-[(2R)-2-ethynylpyrrolidine-1-carbonyl]phenyl]benzonitrile.
| Compound Name | 2-[3-[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]-5-[(2R)-2-ethynylpyrrolidine-1-carbonyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 143127287 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[3-[5-(1-aminoethyl)-1,3,4-oxadiazol-2-yl]-5-[(2R)-2-ethynylpyrrolidine-1-carbonyl]phenyl]benzonitrile |
| SMILES | C#C[C@H]1CCCN1C(=O)c1cc(-c2nnc(C(C)N)o2)cc(-c2ccccc2C#N)c1 |
| InChI | InChI=1S/C24H21N5O2/c1-3-20-8-6-10-29(20)24(30)19-12-17(21-9-5-4-7-16(21)14-25)11-18(13-19)23-28-27-22(31-23)15(2)26/h1,4-5,7,9,11-13,15,20H,6,8,10,26H2,2H3/t15?,20-/m0/s1 |
| InChIKey | FHGIVIPRJXSEET-MBABXSBOSA-N |
| XLogP | 3.53 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|