C13H14F3NOS — CID 143128648
1-[5-[(E)-but-1-enyl]-4-[(Z)-prop-1-enyl]-1,3-thiazol-2-yl]-3,3,3-trifluoroprop-1-en-2-ol (PubChem CID 143128648) has the molecular formula C13H14F3NOS and a molecular weight of 289.32 g/mol. Its IUPAC name is 1-[5-[(E)-but-1-enyl]-4-[(Z)-prop-1-enyl]-1,3-thiazol-2-yl]-3,3,3-trifluoroprop-1-en-2-ol.
| Compound Name | 1-[5-[(E)-but-1-enyl]-4-[(Z)-prop-1-enyl]-1,3-thiazol-2-yl]-3,3,3-trifluoroprop-1-en-2-ol |
|---|---|
| PubChem CID | 143128648 |
| Molecular Formula | C13H14F3NOS |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-[5-[(E)-but-1-enyl]-4-[(Z)-prop-1-enyl]-1,3-thiazol-2-yl]-3,3,3-trifluoroprop-1-en-2-ol |
| SMILES | C/C=C\c1nc(C=C(O)C(F)(F)F)sc1/C=C/CC |
| InChI | InChI=1S/C13H14F3NOS/c1-3-5-7-10-9(6-4-2)17-12(19-10)8-11(18)13(14,15)16/h4-8,18H,3H2,1-2H3/b6-4-,7-5+,11-8? |
| InChIKey | CQSPLXUVWTZBOA-JWVXNBDDSA-N |
| XLogP | 5.06 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|