C27H35Cl2N3O2 — CID 143128730
4-(5,6-dichloro-1H-indol-2-yl)-3-ethoxybenzaldehyde;N,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 143128730) has the molecular formula C27H35Cl2N3O2 and a molecular weight of 504.50 g/mol. Its IUPAC name is 4-(5,6-dichloro-1H-indol-2-yl)-3-ethoxybenzaldehyde;N,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | 4-(5,6-dichloro-1H-indol-2-yl)-3-ethoxybenzaldehyde;N,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 143128730 |
| Molecular Formula | C27H35Cl2N3O2 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 4-(5,6-dichloro-1H-indol-2-yl)-3-ethoxybenzaldehyde;N,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | CCOc1cc(C=O)ccc1-c1cc2cc(Cl)c(Cl)cc2[nH]1.CNC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H13Cl2NO2.C10H22N2/c1-2-22-17-5-10(9-21)3-4-12(17)16-7-11-6-13(18)14(19)8-15(11)20-16;1-9(2)6-8(11-5)7-10(3,4)12-9/h3-9,20H,2H2,1H3;8,11-12H,6-7H2,1-5H3 |
| InChIKey | QZKUVFSOYMPVJT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|