C33H38Cl2N2O — CID 143128756
6-[(E)-1-amino-1-(4-chlorophenyl)-2-methylpent-2-enyl]-4-(3-chlorophenyl)-1-methylquinolin-2-one;ethane;prop-1-ene (PubChem CID 143128756) has the molecular formula C33H38Cl2N2O and a molecular weight of 549.59 g/mol. Its IUPAC name is 6-[(E)-1-amino-1-(4-chlorophenyl)-2-methylpent-2-enyl]-4-(3-chlorophenyl)-1-methylquinolin-2-one;ethane;prop-1-ene.
| Compound Name | 6-[(E)-1-amino-1-(4-chlorophenyl)-2-methylpent-2-enyl]-4-(3-chlorophenyl)-1-methylquinolin-2-one;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143128756 |
| Molecular Formula | C33H38Cl2N2O |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 6-[(E)-1-amino-1-(4-chlorophenyl)-2-methylpent-2-enyl]-4-(3-chlorophenyl)-1-methylquinolin-2-one;ethane;prop-1-ene |
| SMILES | C=CC.CC.CC/C=C(\C)C(N)(c1ccc(Cl)cc1)c1ccc2c(c1)c(-c1cccc(Cl)c1)cc(=O)n2C |
| InChI | InChI=1S/C28H26Cl2N2O.C3H6.C2H6/c1-4-6-18(2)28(31,20-9-12-22(29)13-10-20)21-11-14-26-25(16-21)24(17-27(33)32(26)3)19-7-5-8-23(30)15-19;1-3-2;1-2/h5-17H,4,31H2,1-3H3;3H,1H2,2H3;1-2H3/b18-6+;; |
| InChIKey | HHDIDUSLMQUKHX-KEPFFZHYSA-N |
| XLogP | 9.29 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|